Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Rare Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 (431) 5606-600 | |||
|
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Name | 3-(4-Biphenylyl)-3-{[(9H-Fluoren-9-Ylmethoxy)Carbonyl]Amino}Propanoic Acid |
|---|---|
| Synonyms | Fmoc-(R,S)-3-amino-3-(biphenyl)propionic acid |
| Molecular Structure | ![CAS#: 269078-79-7， 3-(4-Biphenylyl)-3-{[(9H-Fluoren-9-Ylmethoxy)Carbonyl]Amino}Propanoic Acid](/moreStructures/269078-79-7.gif) |
| Molecular Formula | C30H25NO4 |
| Molecular Weight | 463.52 |
| CAS Registry Number | 269078-79-7 |
| SMILES | O=C(O)CC(c2ccc(c1ccccc1)cc2)NC(=O)OCC5c3ccccc3c4c5cccc4 |
| InChI | 1S/C30H25NO4/c32-29(33)18-28(22-16-14-21(15-17-22)20-8-2-1-3-9-20)31-30(34)35-19-27-25-12-6-4-10-23(25)24-11-5-7-13-26(24)27/h1-17,27-28H,18-19H2,(H,31,34)(H,32,33) |
| InChIKey | PEYWNXMITXNNRZ-UHFFFAOYSA-N |
| Density | 1.256g/cm3 (Cal.) |
|---|---|
| Boiling point | 698.607°C at 760 mmHg (Cal.) |
| Flash point | 376.304°C (Cal.) |
| Refractive index | 1.64 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Biphenylyl)-3-{[(9H-Fluoren-9-Ylmethoxy)Carbonyl]Amino}Propanoic Acid |