Online Database of Chemicals from Around the World
|
CAS#: 27031-18-1 Product: Phenyl (Chloroformyl)Phenylacetate No suppilers available for the product. |
| Name | Phenyl (Chloroformyl)Phenylacetate |
|---|---|
| Synonyms | Phenyl 2-(2-Chlorocarbonylphenyl)Acetate; 2-(2-Chlorocarbonylphenyl)Acetic Acid Phenyl Ester; Phenyl 2-(2-Carbonochloridoylphenyl)Ethanoate |
| Molecular Structure |  |
| Molecular Formula | C15H11ClO3 |
| Molecular Weight | 274.70 |
| CAS Registry Number | 27031-18-1 |
| EINECS | 248-177-5 |
| SMILES | C1=CC=CC(=C1C(Cl)=O)CC(OC2=CC=CC=C2)=O |
| InChI | 1S/C15H11ClO3/c16-15(18)13-9-5-4-6-11(13)10-14(17)19-12-7-2-1-3-8-12/h1-9H,10H2 |
| InChIKey | DMHJZMJFAQSDJW-UHFFFAOYSA-N |
| Density | 1.283g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.505°C at 760 mmHg (Cal.) |
| Flash point | 171.133°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl (Chloroformyl)Phenylacetate |