Online Database of Chemicals from Around the World
|
CAS#: 85153-61-3 Product: Phenyl 2-Chloroacetoacetate No suppilers available for the product. |
| Name | Phenyl 2-Chloroacetoacetate |
|---|---|
| Synonyms | Phenyl 2-Chloro-3-Oxo-Butanoate; 2-Chloro-3-Oxobutanoic Acid Phenyl Ester; 2-Chloro-3-Keto-Butyric Acid Phenyl Ester |
| Molecular Structure |  |
| Molecular Formula | C10H9ClO3 |
| Molecular Weight | 212.63 |
| CAS Registry Number | 85153-61-3 |
| EINECS | 285-843-4 |
| SMILES | C1=C(OC(=O)C(Cl)C(=O)C)C=CC=C1 |
| InChI | 1S/C10H9ClO3/c1-7(12)9(11)10(13)14-8-5-3-2-4-6-8/h2-6,9H,1H3 |
| InChIKey | ZKORLCBXGZWQFS-UHFFFAOYSA-N |
| Density | 1.258g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.828°C at 760 mmHg (Cal.) |
| Flash point | 126.603°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl 2-Chloroacetoacetate |