| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| ChemPacific Corp | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| ZereneX Molecular Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | 1-(Dichloromethyl)-2-(Trichloromethyl)-Benzene |
|---|---|
| Synonyms | O-Xylene, .Alpha.,.Alpha.,.Alpha.,.Alpha.',.Alpha.'-Pentachloro-; Nsc155825; Alpha,Alpha,Alpha,Alpha',Alpha'-Pentachloro-O-Xylene |
| Molecular Formula | C8H5Cl5 |
| Molecular Weight | 278.39 |
| CAS Registry Number | 2741-57-3 |
| EINECS | 220-371-4 |
| SMILES | C1=CC=CC(=C1C(Cl)(Cl)Cl)C(Cl)Cl |
| InChI | 1S/C8H5Cl5/c9-7(10)5-3-1-2-4-6(5)8(11,12)13/h1-4,7H |
| InChIKey | UXMNSLMVCBBGCW-UHFFFAOYSA-N |
| Density | 1.542g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.16°C at 760 mmHg (Cal.) |
| Flash point | 142.074°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Dichloromethyl)-2-(Trichloromethyl)-Benzene |