Online Database of Chemicals from Around the World
|
CAS#: 660-23-1 Product: Dichloromethyl[3-(2,2,2-Trifluoroethoxy)Propyl]Silane No suppilers available for the product. |
| Name | Dichloromethyl[3-(2,2,2-Trifluoroethoxy)Propyl]Silane |
|---|---|
| Synonyms | Dichloromethyl(3-(2,2,2-Trifluoroethoxy)Propyl)Silane |
| Molecular Structure | ![CAS#: 660-23-1， Dichloromethyl[3-(2,2,2-Trifluoroethoxy)Propyl]Silane](/moreStructures/660-23-1.gif) |
| Molecular Formula | C6H11Cl2F3OSi |
| Molecular Weight | 255.14 |
| CAS Registry Number | 660-23-1 |
| EINECS | 211-537-7 |
| SMILES | C(C(F)(F)F)OCCC[Si](Cl)(Cl)C |
| InChI | 1S/C6H11Cl2F3OSi/c1-13(7,8)4-2-3-12-5-6(9,10)11/h2-5H2,1H3 |
| InChIKey | FSMJBBPNUINECE-UHFFFAOYSA-N |
| Density | 1.222g/cm3 (Cal.) |
|---|---|
| Boiling point | 163.744°C at 760 mmHg (Cal.) |
| Flash point | 52.831°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dichloromethyl[3-(2,2,2-Trifluoroethoxy)Propyl]Silane |