Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-(3-Aminophenyl)-2,2-Dichloroethanone |
|---|---|
| Synonyms | 1-(3-aminophenyl)-2,2-dichloroethanone |
| Molecular Structure |  |
| Molecular Formula | C8H7Cl2NO |
| Molecular Weight | 204.05 |
| CAS Registry Number | 27700-45-4 |
| SMILES | c1cc(cc(c1)N)C(=O)C(Cl)Cl |
| InChI | 1S/C8H7Cl2NO/c9-8(10)7(12)5-2-1-3-6(11)4-5/h1-4,8H,11H2 |
| InChIKey | JRRYMSJCAVMOKR-UHFFFAOYSA-N |
| Density | 1.394g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.879°C at 760 mmHg (Cal.) |
| Flash point | 166.611°C (Cal.) |
| Refractive index | 1.601 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3-Aminophenyl)-2,2-Dichloroethanone |