Online Database of Chemicals from Around the World
|
CAS#: 72017-90-4 Product: 4-(4-Aminophenyl)Diazenyl-2-Methoxyaniline No suppilers available for the product. |
| Name | 4-(4-Aminophenyl)Diazenyl-2-Methoxyaniline |
|---|---|
| Synonyms | 4-(4-Aminophenyl)Azo-2-Methoxy-Aniline; 4-(4-Aminophenyl)Azo-2-Methoxyaniline; [4-(4-Aminophenyl)Azo-2-Methoxy-Phenyl]Amine |
| Molecular Structure |  |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 |
| CAS Registry Number | 72017-90-4 |
| SMILES | C1=C(C=CC(=C1)N=NC2=CC(=C(C=C2)N)OC)N |
| InChI | 1S/C13H14N4O/c1-18-13-8-11(6-7-12(13)15)17-16-10-4-2-9(14)3-5-10/h2-8H,14-15H2,1H3 |
| InChIKey | YEWHSVBZJKUKRI-UHFFFAOYSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.562°C at 760 mmHg (Cal.) |
| Flash point | 233.549°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Aminophenyl)Diazenyl-2-Methoxyaniline |