| Biosynth AG. | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Chemodex Ltd. | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (71) 244-4825 | |||
![]() |
info@chemodex.com | |||
| Chemical distributor | ||||
| Name | 8-Hydroxy-1,3,6-Pyrenetrisulfonic Acid |
|---|---|
| Synonyms | 11389 Green; 1-hydroxypyrene-3,6,8-trisulfonic acid; 8-hydroxy-1,3,6-pyrene trisulfonic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C16H10O10S3 |
| Molecular Weight | 458.44 |
| CAS Registry Number | 27928-00-3 |
| SMILES | C1=CC2=C3C(=C(C=C2S(=O)(=O)O)S(=O)(=O)O)C=CC4=C(C=C(C1=C43)O)S(=O)(=O)O |
| InChI | 1S/C16H10O10S3/c17-11-5-12(27(18,19)20)8-3-4-10-14(29(24,25)26)6-13(28(21,22)23)9-2-1-7(11)15(8)16(9)10/h1-6,17H,(H,18,19,20)(H,21,22,23)(H,24,25,26) |
| InChIKey | OBJOZRVSMLPASY-UHFFFAOYSA-N |
| Density | 2.0±0.1g/cm3 (Cal.) |
|---|---|
| Refractive index | 1.874 (Cal.) |
| (1) | Irene Izzo, Sabina Licen, Nakia Maulucci, Giuseppina Autore, Stefania Marzocco, Paolo Tecilla and Francesco De Riccardis. Cationic calix[4]arenes as anion-selective ionophores, Chem. Commun., 2008, 2986. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 8-Hydroxy-1,3,6-Pyrenetrisulfonic Acid |