Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N-(8-Hydroxy(Pyren-1-Yl))-Acetamide |
|---|---|
| Synonyms | N-(8-Hydroxy-1-Pyrenyl)Acetamide; N-(8-Hydroxypyren-1-Yl)Ethanamide; 1-Acetamidopyren-8-Ol |
| Molecular Structure |  |
| Molecular Formula | C18H13NO2 |
| Molecular Weight | 275.31 |
| CAS Registry Number | 91598-92-4 |
| SMILES | C3=CC1=C(O)C=CC2=CC=C4C(=C12)C3=C(NC(=O)C)C=C4 |
| InChI | 1S/C18H13NO2/c1-10(20)19-15-8-4-11-2-3-12-5-9-16(21)14-7-6-13(15)17(11)18(12)14/h2-9,21H,1H3,(H,19,20) |
| InChIKey | JVSYZGLUYQMVQJ-UHFFFAOYSA-N |
| Density | 1.423g/cm3 (Cal.) |
|---|---|
| Boiling point | 599.022°C at 760 mmHg (Cal.) |
| Flash point | 316.077°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(8-Hydroxy(Pyren-1-Yl))-Acetamide |