| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 2,3,5,6-Tetrafluoro-N,N-Dimethyl-4-(Trifluoromethyl)Aniline |
|---|---|
| Synonyms | 4-Dimethylaminoheptafluorotoluene; dimethyl[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]amine; Dimethylaminoheptafluorotoluene |
| Molecular Structure | ![]() |
| Molecular Formula | C9H6F7N |
| Molecular Weight | 261.14 |
| CAS Registry Number | 28012-10-4 |
| SMILES | Fc1c(F)c(c(F)c(F)c1N(C)C)C(F)(F)F |
| InChI | 1S/C9H6F7N/c1-17(2)8-6(12)4(10)3(9(14,15)16)5(11)7(8)13/h1-2H3 |
| InChIKey | OAFFGWRKXBLIDD-UHFFFAOYSA-N |
| Density | 1.469g/cm3 (Cal.) |
|---|---|
| Melting point | 36-37°C (Expl.) |
| Boiling point | 206.478°C at 760 mmHg (Cal.) |
| Flash point | 78.675°C (Cal.) |
| Refractive index | 1.426 (Cal.) |
| Safety Description | S24/25,S36/37/39,S45 |
|---|---|
| R36/37/38 | |
| Irritant | |
| Market Analysis Reports |
| List of Reports Available for 2,3,5,6-Tetrafluoro-N,N-Dimethyl-4-(Trifluoromethyl)Aniline |