Online Database of Chemicals from Around the World
|
CAS#: 578-32-5 Product: 2,2',5,5'-Tetrafluoro-4-Dimethylaminoazobenzene No suppilers available for the product. |
| Name | 2,2',5,5'-Tetrafluoro-4-Dimethylaminoazobenzene |
|---|---|
| Synonyms | 4-(2,5-Difluorophenyl)Azo-2,5-Difluoro-N,N-Dimethyl-Aniline; 4-(2,5-Difluorophenyl)Azo-2,5-Difluoro-N,N-Dimethylaniline; [4-(2,5-Difluorophenyl)Azo-2,5-Difluoro-Phenyl]-Dimethyl-Amine |
| Molecular Structure |  |
| Molecular Formula | C14H11F4N3 |
| Molecular Weight | 297.25 |
| CAS Registry Number | 578-32-5 |
| SMILES | C1=C(C(=CC(=C1F)N=NC2=CC(=CC=C2F)F)F)N(C)C |
| InChI | 1S/C14H11F4N3/c1-21(2)14-7-10(17)13(6-11(14)18)20-19-12-5-8(15)3-4-9(12)16/h3-7H,1-2H3 |
| InChIKey | HUVXXCRAQSERKY-UHFFFAOYSA-N |
| Density | 1.286g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.68°C at 760 mmHg (Cal.) |
| Flash point | 188.262°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2',5,5'-Tetrafluoro-4-Dimethylaminoazobenzene |