Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6-Methyl-7H-Purine 3-Oxide |
|---|---|
| Synonyms | 6-methyl-7H-purine 3-oxide |
| Molecular Structure |  |
| Molecular Formula | C6H6N4O |
| Molecular Weight | 150.14 |
| CAS Registry Number | 28199-57-7 |
| SMILES | Cc1c2c(nc[nH]2)[n+](cn1)[O-] |
| InChI | 1S/C6H6N4O/c1-4-5-6(8-2-7-5)10(11)3-9-4/h2-3H,1H3,(H,7,8) |
| InChIKey | NCSGPVADQCUHBX-UHFFFAOYSA-N |
| Density | 1.609g/cm3 (Cal.) |
|---|---|
| Boiling point | 547.374°C at 760 mmHg (Cal.) |
| Flash point | 284.842°C (Cal.) |
| Refractive index | 1.772 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methyl-7H-Purine 3-Oxide |