Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6-Methyl-1H-purin-1-ol |
|---|---|
| Synonyms | 1H-Purine, 1-hydroxy-6-methyl-; 6-methyl-1H-purin-1-ol; NCIOpen2_001596 |
| Molecular Structure |  |
| Molecular Formula | C6H6N4O |
| Molecular Weight | 150.14 |
| CAS Registry Number | 958178-06-8 |
| SMILES | N1=C\N(O)\C(=C/2\N=C/N=C1\2)C |
| InChI | 1S/C6H6N4O/c1-4-5-6(8-2-7-5)9-3-10(4)11/h2-3,11H,1H3 |
| InChIKey | CMSWTHGWUDKMGT-UHFFFAOYSA-N |
| Density | 1.609g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.336°C at 760 mmHg (Cal.) |
| Flash point | 148.139°C (Cal.) |
| Refractive index | 1.772 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methyl-1H-purin-1-ol |