Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 6-Chloro-8-(Trifluoromethyl)-9H-Purine |
|---|---|
| Synonyms | 6-Chloro-8-(Trifluoromethyl)-9H-Purine |
| Molecular Structure |  |
| Molecular Formula | C6H2ClF3N4 |
| Molecular Weight | 222.56 |
| CAS Registry Number | 282522-06-9 |
| SMILES | Clc1ncnc2c1nc([nH]2)C(F)(F)F |
| InChI | 1S/C6H2ClF3N4/c7-3-2-4(12-1-11-3)14-5(13-2)6(8,9)10/h1H,(H,11,12,13,14) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-8-(Trifluoromethyl)-9H-Purine |