Online Database of Chemicals from Around the World
|
CAS#: 28310-13-6 Product: 5-Nitro-1,3-Benzodioxole-4-Carbaldehyde No suppilers available for the product. |
| Name | 5-Nitro-1,3-Benzodioxole-4-Carbaldehyde |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C8H5NO5 |
| Molecular Weight | 195.13 |
| CAS Registry Number | 28310-13-6 |
| SMILES | [O-][N+](=O)c1ccc2OCOc2c1C=O |
| InChI | 1S/C8H5NO5/c10-3-5-6(9(11)12)1-2-7-8(5)14-4-13-7/h1-3H,4H2 |
| InChIKey | NFIMAKMUYBBCOI-UHFFFAOYSA-N |
| Density | 1.572g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.019°C at 760 mmHg (Cal.) |
| Flash point | 195.093°C (Cal.) |
| Refractive index | 1.658 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Nitro-1,3-Benzodioxole-4-Carbaldehyde |