Online Database of Chemicals from Around the World
|
CAS#: 65466-29-7 Product: 3-Nitro-3H-1,5-Benzodiazepine No suppilers available for the product. |
| Name | 3-Nitro-3H-1,5-Benzodiazepine |
|---|---|
| Synonyms | N-Hydroxy-3H-1,5-Benzodiazepin-3-Amine Oxide; N-(3H-1,5-Benzodiazepin-3-Yl)-N-Oxidohydroxylamine; N-(3H-1,5-Benzodiazepin-3-Yl)-N-Oxido-Hydroxylamine |
| Molecular Structure |  |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.17 |
| CAS Registry Number | 65466-29-7 |
| SMILES | C1=C2C(=CC=C1)N=CC(C=N2)[N+](=O)[O-] |
| InChI | 1S/C9H7N3O2/c13-12(14)7-5-10-8-3-1-2-4-9(8)11-6-7/h1-7H |
| InChIKey | SGIGOTZNQITOJU-UHFFFAOYSA-N |
| Density | 1.399g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.261°C at 760 mmHg (Cal.) |
| Flash point | 215.224°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Nitro-3H-1,5-Benzodiazepine |