Online Database of Chemicals from Around the World
|
CAS#: 2839-49-8 Product: 2-Fluoro-9H-Xanthen-9-One No suppilers available for the product. |
| Name | 2-Fluoro-9H-Xanthen-9-One |
|---|---|
| Synonyms | 2-FLUOROXANTHEN-9-ONE |
| Molecular Structure |  |
| Molecular Formula | C13H7FO2 |
| Molecular Weight | 214.19 |
| CAS Registry Number | 2839-49-8 |
| SMILES | Fc2cc1C(=O)c3c(Oc1cc2)cccc3 |
| InChI | 1S/C13H7FO2/c14-8-5-6-12-10(7-8)13(15)9-3-1-2-4-11(9)16-12/h1-7H |
| InChIKey | AWMISBKXHLTLHZ-UHFFFAOYSA-N |
| Density | 1.357g/cm3 (Cal.) |
|---|---|
| Boiling point | 354.437°C at 760 mmHg (Cal.) |
| Flash point | 162.513°C (Cal.) |
| Refractive index | 1.621 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Fluoro-9H-Xanthen-9-One |