Online Database of Chemicals from Around the World
|
CAS#: 523-11-5 Product: 17alpha-Fluoroyohimban No suppilers available for the product. |
| Name | 17alpha-Fluoroyohimban |
|---|---|
| Synonyms | Yohimban, 17-Alpha-Fluoro-; 17-Alpha-Fluoroyohimbane |
| Molecular Structure |  |
| Molecular Formula | C19H23FN2 |
| Molecular Weight | 298.40 |
| CAS Registry Number | 523-11-5 |
| SMILES | [C@H]34C2=C(C1=CC=CC=C1[NH]2)CCN3C[C@H]5[C@H](C4)C[C@H](CC5)F |
| InChI | 1S/C19H23FN2/c20-14-6-5-12-11-22-8-7-16-15-3-1-2-4-17(15)21-19(16)18(22)10-13(12)9-14/h1-4,12-14,18,21H,5-11H2/t12-,13-,14-,18-/m0/s1 |
| InChIKey | OXGSXWBEBGWSNW-NUXNZHGMSA-N |
| Density | 1.239g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.654°C at 760 mmHg (Cal.) |
| Flash point | 233°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 17alpha-Fluoroyohimban |