Online Database of Chemicals from Around the World
|
CAS#: 28399-50-0 Product: Rabelomycin No suppilers available for the product. |
| Name | Rabelomycin |
|---|---|
| Synonyms | C12402; Rabelomycin |
| Molecular Structure |  |
| Molecular Formula | C19H14O6 |
| Molecular Weight | 338.32 |
| CAS Registry Number | 28399-50-0 |
| SMILES | [C@@]4(CC3=C(C2=C(C(C1=C(C=CC=C1O)C2=O)=O)C(=C3)O)C(C4)=O)(O)C |
| InChI | 1S/C19H14O6/c1-19(25)6-8-5-11(21)15-16(13(8)12(22)7-19)17(23)9-3-2-4-10(20)14(9)18(15)24/h2-5,20-21,25H,6-7H2,1H3/t19-/m1/s1 |
| InChIKey | JJOLHRYZQSDLSA-LJQANCHMSA-N |
| Density | 1.576g/cm3 (Cal.) |
|---|---|
| Boiling point | 675.683°C at 760 mmHg (Cal.) |
| Flash point | 376.418°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Rabelomycin |