| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | R 7050 |
|---|---|
| Synonyms | R-7050; R 7050; R7050; TNF-α Antagonist III; 8-chloro-4-phenylsulfanyl-1-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]quinoxaline; 12E-954 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H8ClF3N4S |
| Molecular Weight | 380.77 |
| CAS Registry Number | 303997-35-5 |
| SMILES | C1=CC=C(C=C1)SC2=NC3=C(C=C(C=C3)Cl)N4C2=NN=C4C(F)(F)F |
| InChI | 1S/C16H8ClF3N4S/c17-9-6-7-11-12(8-9)24-13(22-23-15(24)16(18,19)20)14(21-11)25-10-4-2-1-3-5-10/h1-8H |
| InChIKey | SUUMKHOVGVYGOP-UHFFFAOYSA-N |
| solubility | Soluble to 20 mM in DMSO |
|---|---|
| Market Analysis Reports |
| List of Reports Available for R 7050 |