Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | N,N-Dimethyl-1H-Benzoimidazol-2-Amine |
|---|---|
| Synonyms | 1H-Benzimidazol-2-Yl-Dimethyl-Amine; Brn 0124090; Inchi=1/C9h11n3/C1-12(2)9-10-7-5-3-4-6-8(7)11-9/H3-6H,1-2H3,(H,10,11 |
| Molecular Structure |  |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 |
| CAS Registry Number | 2851-13-0 |
| SMILES | C1=CC=CC2=C1N=C([NH]2)N(C)C |
| InChI | 1S/C9H11N3/c1-12(2)9-10-7-5-3-4-6-8(7)11-9/h3-6H,1-2H3,(H,10,11) |
| InChIKey | NMTCCVZABWWGSB-UHFFFAOYSA-N |
| Density | 1.211g/cm3 (Cal.) |
|---|---|
| Boiling point | 301.505°C at 760 mmHg (Cal.) |
| Flash point | 136.146°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-1H-Benzoimidazol-2-Amine |