Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1,2-Dimethyl-3H-benzo[e]indol-6-amine |
|---|---|
| Synonyms | 1,2-dimethyl-3H-benzo[e]indol-6-amine |
| Molecular Structure | ![CAS#: 777018-48-1， 1,2-Dimethyl-3H-benzo[e]indol-6-amine](/moreStructures/777018-48-1.gif) |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.27 |
| CAS Registry Number | 777018-48-1 |
| SMILES | Cc1c([nH]c2c1c3cccc(c3cc2)N)C |
| InChI | 1S/C14H14N2/c1-8-9(2)16-13-7-6-10-11(14(8)13)4-3-5-12(10)15/h3-7,16H,15H2,1-2H3 |
| InChIKey | FVLWYMNMCLSWPQ-UHFFFAOYSA-N |
| Density | 1.231g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.059°C at 760 mmHg (Cal.) |
| Flash point | 262.921°C (Cal.) |
| Refractive index | 1.76 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dimethyl-3H-benzo[e]indol-6-amine |