|
CAS#: 2854-38-8 Product: Ergostine No suppilers available for the product. |
| Name | Ergostine |
|---|---|
| Synonyms | Ergotaman-3',6',18-Trione, 2'-Ethyl-12'-Hydroxy-5'-(Phenylmethyl)-, (5'Alpha)- |
| Molecular Structure | ![]() |
| Molecular Formula | C34H37N5O5 |
| Molecular Weight | 595.70 |
| CAS Registry Number | 2854-38-8 |
| SMILES | [C@@H]18C(=C[C@H](CN1C)C(N[C@]4(C(N3[C@@H](C(N2CCC[C@H]2[C@@]3(O4)O)=O)CC5=CC=CC=C5)=O)CC)=O)C6=C7C(=CC=C6)[NH]C=C7C8 |
| InChI | 1S/C34H37N5O5/c1-3-33(36-30(40)22-16-24-23-11-7-12-25-29(23)21(18-35-25)17-26(24)37(2)19-22)32(42)39-27(15-20-9-5-4-6-10-20)31(41)38-14-8-13-28(38)34(39,43)44-33/h4-7,9-12,16,18,22,26-28,35,43H,3,8,13-15,17,19H2,1-2H3,(H,36,40)/t22-,26-,27-,28+,33-,34+/m1/s1 |
| InChIKey | BOLCFGMGGWCOOE-UQNXEMKDSA-N |
| Density | 1.455g/cm3 (Cal.) |
|---|---|
| Boiling point | 916.197°C at 760 mmHg (Cal.) |
| Flash point | 507.898°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ergostine |