Online Database of Chemicals from Around the World
|
CAS#: 80525-49-1 Product: Ergosta-5,22,25-Trien-3-Ol No suppilers available for the product. |
| Name | Ergosta-5,22,25-Trien-3-Ol |
|---|---|
| Synonyms | (3S,8S,9S,10R,13R,14S,17R)-10,13-Dimethyl-17-[(1R,2E,4S)-1,4,5-Trimethylhexa-2,5-Dienyl]-2,3,4,7,8,9,11,12,14,15,16,17-Dodecahydro-1H-Cyclopenta[A]Phenanthren-3-Ol; Ergosta-5,22,25-Trien-3-Ol, (3Beta,22E)-; 22-Eg-Tbo |
| Molecular Structure |  |
| Molecular Formula | C28H44O |
| Molecular Weight | 396.66 |
| CAS Registry Number | 80525-49-1 |
| SMILES | [C@]24([C@H]([C@@H]1CC=C3[C@@]([C@H]1CC2)(CC[C@H](O)C3)C)CC[C@@H]4[C@@H](/C=C/[C@@H](C(=C)C)C)C)C |
| InChI | 1S/C28H44O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-9,19-20,22-26,29H,1,10-17H2,2-6H3/b8-7+/t19-,20+,22-,23-,24+,25-,26-,27-,28+/m0/s1 |
| InChIKey | HRPSGINBXAVYDY-ZAUYPBDWSA-N |
| Density | 1.002g/cm3 (Cal.) |
|---|---|
| Boiling point | 493.099°C at 760 mmHg (Cal.) |
| Flash point | 213.855°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ergosta-5,22,25-Trien-3-Ol |