Online Database of Chemicals from Around the World
| Name | Heptachloro-1,1'-Biphenyl |
|---|---|
| Synonyms | 1,1'-Biphenyl, Heptachloro-; Heptachlorobiphenyl |
| Molecular Structure |  |
| Molecular Formula | C12H3Cl7 |
| Molecular Weight | 395.33 |
| CAS Registry Number | 28655-71-2 |
| EINECS | 249-129-6 |
| SMILES | C2=C(C1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)C(=C(C=C2)Cl)Cl |
| InChI | 1S/C12H3Cl7/c13-5-3-1-2-4(7(5)14)6-8(15)10(17)12(19)11(18)9(6)16/h1-3H |
| InChIKey | PAYFWJAKKLILIT-UHFFFAOYSA-N |
| Density | 1.658g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.952°C at 760 mmHg (Cal.) |
| Flash point | 201.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Heptachloro-1,1'-Biphenyl |
