Online Database of Chemicals from Around the World
| Name | Heptachlorobicyclo[2.2.1]Hept-2-Ene |
|---|---|
| Synonyms | Bicyclo(2.2.1)Hept-2-Ene, Heptachloro-; Bicyclo(2.2.1)Heptene, Heptachloro- |
| Molecular Structure | ![CAS#: 28680-45-7， Heptachlorobicyclo[2.2.1]Hept-2-Ene](/moreStructures/28680-45-7.gif) |
| Molecular Formula | C7H3Cl7 |
| Molecular Weight | 335.27 |
| CAS Registry Number | 28680-45-7 |
| EINECS | 249-153-7 |
| SMILES | ClC12C(C(C(C1Cl)Cl)(C=C2Cl)Cl)(Cl)Cl |
| InChI | 1S/C7H3Cl7/c8-2-1-5(11)3(9)4(10)6(2,12)7(5,13)14/h1,3-4H |
| InChIKey | PXTADLCAVHRXCA-UHFFFAOYSA-N |
| Density | 1.825g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.065°C at 760 mmHg (Cal.) |
| Flash point | 169.956°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Heptachlorobicyclo[2.2.1]Hept-2-Ene |
