| AEchem Scientific Corporation | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (630) 364-5106 | |||
![]() |
info@aechemsc.com | |||
| Chemical manufacturer | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | Diethyl 3-Methyl-1H-Pyrrole-2,5-Dicarboxylate |
|---|---|
| Synonyms | 3-Methyl-pyrrole-2,5-dicarboxylic acid diethyl ester; Diethyl 3-methyl-1H-pyrrole-2,5-dicarboxylate #; ethyl 5-(ethoxycarbonyl)-3-methylpyrrole-2-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 |
| CAS Registry Number | 29170-87-4 |
| SMILES | O=C(OCC)c1c(cc(C(=O)OCC)n1)C |
| InChI | 1S/C11H15NO4/c1-4-15-10(13)8-6-7(3)9(12-8)11(14)16-5-2/h6,12H,4-5H2,1-3H3 |
| InChIKey | HIHHBIPXHZOHJJ-UHFFFAOYSA-N |
| Density | 1.168g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.787°C at 760 mmHg (Cal.) |
| Flash point | 162.322°C (Cal.) |
| Refractive index | 1.517 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl 3-Methyl-1H-Pyrrole-2,5-Dicarboxylate |