Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BioBlocks Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (858) 558-5900 | |||
|
sales@bioblocks.com | |||
| Chemical manufacturer | ||||
| Name | Diethyl 8-methyl-2,3-quinolinedicarboxylate |
|---|---|
| Synonyms | Diethyl 8-methyl-2,3-quinolinedicarboxylate; Diethyl-8-methyl-2,3-quinolinedicarboxylate |
| Molecular Structure |  |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 |
| CAS Registry Number | 892874-76-9 |
| SMILES | CCOC(=O)c1cc2cccc(C)c2nc1C(=O)OCC |
| InChI | 1S/C16H17NO4/c1-4-20-15(18)12-9-11-8-6-7-10(3)13(11)17-14(12)16(19)21-5-2/h6-9H,4-5H2,1-3H3 |
| InChIKey | LXAYTSGRZUPJDF-UHFFFAOYSA-N |
| Density | 1.188g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.414°C at 760 mmHg (Cal.) |
| Flash point | 188.101°C (Cal.) |
| Refractive index | 1.574 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl 8-methyl-2,3-quinolinedicarboxylate |