Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N-(2,6-Dimethylphenyl)-2-Hydroxy-Propanamide |
|---|---|
| Synonyms | N-(2,6-Dimethylphenyl)-2-Hydroxy-Propanamide; N-(2,6-Dimethylphenyl)-2-Hydroxy-Propionamide; Lactoxylidide |
| Molecular Structure |  |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 |
| CAS Registry Number | 29183-17-3 |
| SMILES | C1=C(C(=C(C=C1)C)NC(C(C)O)=O)C |
| InChI | 1S/C11H15NO2/c1-7-5-4-6-8(2)10(7)12-11(14)9(3)13/h4-6,9,13H,1-3H3,(H,12,14) |
| InChIKey | DPZBSZHXRYUEPE-UHFFFAOYSA-N |
| Density | 1.14g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.255°C at 760 mmHg (Cal.) |
| Flash point | 160.791°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2,6-Dimethylphenyl)-2-Hydroxy-Propanamide |