Online Database of Chemicals from Around the World
|
CAS#: 70974-10-6 Product: 5,5-Dimethyl-3-Phenyl-Imidazolidine-2,4-Dione No suppilers available for the product. |
| Name | 5,5-Dimethyl-3-Phenyl-Imidazolidine-2,4-Dione |
|---|---|
| Synonyms | 5,5-Dimethyl-3-Phenyl-Imidazolidine-2,4-Dione; 5,5-Dimethyl-3-Phenyl-Hydantoin; 2,4-Imidazolidinedione, 5,5-Dimethyl-3-Phenyl- |
| Molecular Structure |  |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 |
| CAS Registry Number | 70974-10-6 |
| SMILES | C1=CC=CC=C1N2C(C(C)(C)NC2=O)=O |
| InChI | 1S/C11H12N2O2/c1-11(2)9(14)13(10(15)12-11)8-6-4-3-5-7-8/h3-7H,1-2H3,(H,12,15) |
| InChIKey | YAEXYISATSGZDB-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for 5,5-Dimethyl-3-Phenyl-Imidazolidine-2,4-Dione |