Online Database of Chemicals from Around the World
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (732) 355-9920 | |||
 |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Vitas-M | Russian Federation | Inquire | ||
|---|---|---|---|---|
|
+7 (906) 781-2021 | |||
|
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 4-Fluorophenyl 4-Chlorobenzoate |
|---|---|
| Synonyms | 4-Chlorobenzoic Acid (4-Fluorophenyl) Ester; 4-Fluorophenyl 4-Chlorobenzoate |
| Molecular Structure |  |
| Molecular Formula | C13H8ClFO2 |
| Molecular Weight | 250.66 |
| CAS Registry Number | 29558-88-1 |
| EINECS | 249-695-4 |
| SMILES | C2=C(C(OC1=CC=C(F)C=C1)=O)C=CC(=C2)Cl |
| InChI | 1S/C13H8ClFO2/c14-10-3-1-9(2-4-10)13(16)17-12-7-5-11(15)6-8-12/h1-8H |
| InChIKey | QFOOQWZABMLXPS-UHFFFAOYSA-N |
| Density | 1.326g/cm3 (Cal.) |
|---|---|
| Boiling point | 354.213°C at 760 mmHg (Cal.) |
| Flash point | 148.649°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Fluorophenyl 4-Chlorobenzoate |