Online Database of Chemicals from Around the World
| Name | 2-[(4-Fluorophenyl)carbonoimidoyl]phenol |
|---|---|
| Synonyms | 2-(((4-fluorophenyl)imino)methyl)phenol |
| Molecular Structure | ![CAS#: 3382-62-5， 2-[(4-Fluorophenyl)carbonoimidoyl]phenol](/moreStructures/3382-62-5.gif) |
| Molecular Formula | C13H10FNO |
| Molecular Weight | 215.22 |
| CAS Registry Number | 3382-62-5 |
| SMILES | Oc2ccccc2\C=N/c1ccc(F)cc1 |
| InChI | 1S/C13H10FNO/c14-11-5-7-12(8-6-11)15-9-10-3-1-2-4-13(10)16/h1-9,16H |
| InChIKey | COFLOZFCNFCJFM-UHFFFAOYSA-N |
| Density | 1.134g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.417°C at 760 mmHg (Cal.) |
| Flash point | 168.75°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(4-Fluorophenyl)carbonoimidoyl]phenol |
