Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 8-Acetamido-2-Naphthyl Acetate |
|---|---|
| Synonyms | 8-Acetamido-2-naphthyl acetate; 8-Acetamido-2-naphthyl-acetat; 8-ACETAMIDONAPHTHALEN-2-YLACETATE |
| Molecular Structure |  |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 |
| CAS Registry Number | 29921-56-0 |
| SMILES | CC(=O)Nc1cccc2c1cc(cc2)OC(=O)C |
| InChI | 1S/C14H13NO3/c1-9(16)15-14-5-3-4-11-6-7-12(8-13(11)14)18-10(2)17/h3-8H,1-2H3,(H,15,16) |
| InChIKey | ZJRDCIAHXPSCHO-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 479.2±18.0°C at 760 mmHg (Cal.) |
| Flash point | 243.6±21.2°C (Cal.) |
| Refractive index | 1.637 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Acetamido-2-Naphthyl Acetate |