Online Database of Chemicals from Around the World
| Florida Center for Heterocyclic Compounds | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (352) 392-0554 | |||
 |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Name | 4-Acetamido-3-Nitroacetophenone |
|---|---|
| Synonyms | N-(4-Acetyl-2-Nitro-Phenyl)Acetamide; N-(4-Ethanoyl-2-Nitro-Phenyl)Ethanamide; Nsc145005 |
| Molecular Structure |  |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 |
| CAS Registry Number | 7418-44-2 |
| SMILES | C1=C([N+]([O-])=O)C(=CC=C1C(=O)C)NC(=O)C |
| InChI | 1S/C10H10N2O4/c1-6(13)8-3-4-9(11-7(2)14)10(5-8)12(15)16/h3-5H,1-2H3,(H,11,14) |
| InChIKey | AQEFIRMOFYNFKT-UHFFFAOYSA-N |
| Density | 1.339g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.327°C at 760 mmHg (Cal.) |
| Flash point | 206.192°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Acetamido-3-Nitroacetophenone |