Online Database of Chemicals from Around the World
|
CAS#: 30148-97-1 Product: 4-(3,4-Dichlorophenyl)-2-Methyl-1,2,4-Oxadiazinane-3,6-Dione No suppilers available for the product. |
| Name | 4-(3,4-Dichlorophenyl)-2-Methyl-1,2,4-Oxadiazinane-3,6-Dione |
|---|---|
| Synonyms | 4-(3,4-Dichlorophenyl)-2-Methyl-1,2,4-Oxadiazinane-3,6-Quinone; 2H-1,2,4-Oxadiazine-3,6-Dione, Dihydro-4-(3,4-Dichlorophenyl)-2-Methyl-; Dihydro-4-(3,4-Dichlorophenyl)-2-Methyl-2H-1,2,4-Oxadiazine-3,6-Dione |
| Molecular Structure |  |
| Molecular Formula | C10H8Cl2N2O3 |
| Molecular Weight | 275.09 |
| CAS Registry Number | 30148-97-1 |
| SMILES | C1=C(C(=CC=C1N2C(N(OC(C2)=O)C)=O)Cl)Cl |
| InChI | 1S/C10H8Cl2N2O3/c1-13-10(16)14(5-9(15)17-13)6-2-3-7(11)8(12)4-6/h2-4H,5H2,1H3 |
| InChIKey | ALWRFUWBKAJPBD-UHFFFAOYSA-N |
| Density | 1.522g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.486°C at 760 mmHg (Cal.) |
| Flash point | 181.493°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3,4-Dichlorophenyl)-2-Methyl-1,2,4-Oxadiazinane-3,6-Dione |