Online Database of Chemicals from Around the World
| Name | 1-(Dichlorophenylmethyl)-4-Nitrobenzene |
|---|---|
| Synonyms | 1,2-Dichloro-3-(4-Nitrobenzyl)Benzene; 1-(Dichlorophenylmethyl)-4-Nitrobenzene |
| Molecular Structure |  |
| Molecular Formula | C13H9Cl2NO2 |
| Molecular Weight | 282.13 |
| CAS Registry Number | 63068-97-3 |
| EINECS | 263-837-2 |
| SMILES | C1=C([N+]([O-])=O)C=CC(=C1)CC2=C(Cl)C(=CC=C2)Cl |
| InChI | 1S/C13H9Cl2NO2/c14-12-3-1-2-10(13(12)15)8-9-4-6-11(7-5-9)16(17)18/h1-7H,8H2 |
| InChIKey | XJDKJTBFXIKUTM-UHFFFAOYSA-N |
| Density | 1.379g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.11°C at 760 mmHg (Cal.) |
| Flash point | 201.223°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Dichlorophenylmethyl)-4-Nitrobenzene |
