Online Database of Chemicals from Around the World
|
CAS#: 30343-72-7 Product: Thiobinupharidine No suppilers available for the product. |
| Name | Thiobinupharidine |
|---|---|
| Synonyms | Thiobinupharidine |
| Molecular Structure |  |
| Molecular Formula | C30H42N2O2S |
| Molecular Weight | 494.73 |
| CAS Registry Number | 30343-72-7 |
| SMILES | [C@@]15(C[C@]2(SC1)CN3[C@@H](CC2)[C@@H](CC[C@H]3C4=COC=C4)C)CN6[C@@H](CC5)[C@@H](CC[C@H]6C7=COC=C7)C |
| InChI | 1S/C30H42N2O2S/c1-21-3-5-27(23-9-13-33-15-23)31-18-29(11-7-25(21)31)17-30(35-20-29)12-8-26-22(2)4-6-28(32(26)19-30)24-10-14-34-16-24/h9-10,13-16,21-22,25-28H,3-8,11-12,17-20H2,1-2H3/t21-,22-,25+,26+,27+,28+,29+,30+/m1/s1 |
| InChIKey | WBMOHCBEBDKSBI-JYZUVFRYSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 601.131°C at 760 mmHg (Cal.) |
| Flash point | 317.353°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Thiobinupharidine |