Online Database of Chemicals from Around the World
|
CAS#: 82422-25-1 Product: Thiobenzyl N-Heptafluorobutyrylanthranilate No suppilers available for the product. |
| Name | Thiobenzyl N-Heptafluorobutyrylanthranilate |
|---|---|
| Synonyms | 2-[(2,2,3,3,4,4,4-Heptafluoro-1-Oxobutyl)Amino]Benzenecarbothioic Acid S-(Phenylmethyl) Ester; 2-(2,2,3,3,4,4,4-Heptafluorobutanoylamino)Thiobenzoic Acid S-(Benzyl) Ester; Thiobenzyl N-Heptafluorobutyrylanthranilate |
| Molecular Structure |  |
| Molecular Formula | C18H12F7NO2S |
| Molecular Weight | 439.35 |
| CAS Registry Number | 82422-25-1 |
| SMILES | C1=C(C(=CC=C1)C(=O)SCC2=CC=CC=C2)NC(C(C(C(F)(F)F)(F)F)(F)F)=O |
| InChI | 1S/C18H12F7NO2S/c19-16(20,17(21,22)18(23,24)25)15(28)26-13-9-5-4-8-12(13)14(27)29-10-11-6-2-1-3-7-11/h1-9H,10H2,(H,26,28) |
| InChIKey | QQIQOXWHMJDAHF-UHFFFAOYSA-N |
| Density | 1.464g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.767°C at 760 mmHg (Cal.) |
| Flash point | 228.23°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Thiobenzyl N-Heptafluorobutyrylanthranilate |