Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 18alpha(h)-Oleanane |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C30H52 |
| Molecular Weight | 412.74 |
| CAS Registry Number | 30759-92-3 |
| SMILES | [C@@]34([C@]1([C@@H]([C@@]2(C(CC1)C(CCC2)(C)C)C)CC[C@@H]3[C@@H]5[C@@](CC4)(CCC(C5)(C)C)C)C)C |
| InChI | 1S/C30H52/c1-25(2)16-17-27(5)18-19-29(7)21(22(27)20-25)10-11-24-28(6)14-9-13-26(3,4)23(28)12-15-30(24,29)8/h21-24H,9-20H2,1-8H3/t21-,22-,23?,24-,27-,28+,29-,30-/m1/s1 |
| InChIKey | VCNKUCWWHVTTBY-AOZKJORISA-N |
| Density | 0.917g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.875°C at 760 mmHg (Cal.) |
| Flash point | 220.805°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 18alpha(h)-Oleanane |