| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | H-Ala-Gly-Gly-OH |
|---|---|
| Synonyms | 2-[[2-[(2-Amino-1-Oxopropyl)Amino]-1-Oxoethyl]Amino]Acetic Acid; 2-[[2-(Alanylamino)Acetyl]Amino]Acetic Acid; 2-[2-(2-Aminopropanoylamino)Ethanoylamino]Ethanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C7H13N3O4 |
| Molecular Weight | 203.20 |
| CAS Registry Number | 3146-40-5 |
| EINECS | 221-559-9 |
| SMILES | C(C(=O)O)NC(=O)CNC(=O)C(N)C |
| InChI | 1S/C7H13N3O4/c1-4(8)7(14)10-2-5(11)9-3-6(12)13/h4H,2-3,8H2,1H3,(H,9,11)(H,10,14)(H,12,13) |
| InChIKey | VGPWRRFOPXVGOH-UHFFFAOYSA-N |
| Density | 1.314g/cm3 (Cal.) |
|---|---|
| Melting point | 198°C (Expl.) |
| Boiling point | 604.639°C at 760 mmHg (Cal.) |
| Flash point | 319.475°C (Cal.) |
| (1) | Zhehong Gan. Measuring nitrogen quadrupolar coupling with 13C detected wide-line 14N NMR under magic-angle spinning, Chem. Commun., 2008, 868. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for H-Ala-Gly-Gly-OH |