Online Database of Chemicals from Around the World
| Name | 3-Bromo-1H-Dibenzo[De,H]Quinoline-2,7-Dione |
|---|---|
| Molecular Structure | ![CAS#: 31715-46-5， 3-Bromo-1H-Dibenzo[De,H]Quinoline-2,7-Dione](/moreStructures/31715-46-5.gif) |
| Molecular Formula | C16H8BrNO2 |
| Molecular Weight | 326.14 |
| CAS Registry Number | 31715-46-5 |
| EINECS | 250-776-1 |
| SMILES | BrC1=C3C=CC=C2C(=O)c4ccccc4C(NC1=O)=C23 |
| InChI | 1S/C16H8BrNO2/c17-13-10-6-3-7-11-12(10)14(18-16(13)20)8-4-1-2-5-9(8)15(11)19/h1-7H,(H,18,20) |
| InChIKey | FULFOKOOHYNUNC-UHFFFAOYSA-N |
| Density | 1.764g/cm3 (Cal.) |
|---|---|
| Boiling point | 637.63°C at 760 mmHg (Cal.) |
| Flash point | 339.426°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Bromo-1H-Dibenzo[De,H]Quinoline-2,7-Dione |
