|
CAS#: 321745-84-0 Product: 6-(1-Methyl-4-Piperidinyl)-1H-Indole No suppilers available for the product. |
| Name | 6-(1-Methyl-4-Piperidinyl)-1H-Indole |
|---|---|
| Synonyms | 1H-Indole, 6-(1-methyl-4-piperidinyl)-; 6-(1-Methyl-4-piperidinyl)-1H-indol; 6-(1-Methyl-4-piperidinyl)-1H-indole |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 |
| CAS Registry Number | 321745-84-0 |
| SMILES | CN1CCC(CC1)c2ccc3cc[nH]c3c2 |
| InChI | 1S/C14H18N2/c1-16-8-5-11(6-9-16)13-3-2-12-4-7-15-14(12)10-13/h2-4,7,10-11,15H,5-6,8-9H2,1H3 |
| InChIKey | QVEINKHQGZOIBG-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.4±35.0°C at 760 mmHg (Cal.) |
| Flash point | 179.6±25.9°C (Cal.) |
| Refractive index | 1.618 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(1-Methyl-4-Piperidinyl)-1H-Indole |