Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 5-(1-Methyl-4-piperidinyl)-1H-indazole |
|---|---|
| Synonyms | 1H-Indazole, 5-(1-methyl-4-piperidinyl)-; 1H-INDAZOLE,5-(1-METHYL-4-PIPERIDINYL)-; 5-(1-Methyl-4-piperidinyl)-1H-indazol |
| Molecular Structure |  |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.29 |
| CAS Registry Number | 885272-53-7 |
| SMILES | CN1CCC(CC1)c2ccc3c(c2)cn[nH]3 |
| InChI | 1S/C13H17N3/c1-16-6-4-10(5-7-16)11-2-3-13-12(8-11)9-14-15-13/h2-3,8-10H,4-7H2,1H3,(H,14,15) |
| InChIKey | ZQMVGZWZVMGNTJ-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.1±35.0°C at 760 mmHg (Cal.) |
| Flash point | 184.9±25.9°C (Cal.) |
| Refractive index | 1.624 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(1-Methyl-4-piperidinyl)-1H-indazole |