|
CAS#: 32702-05-9 Product: (1,5-Diphenyl-1H-Pyrazol-4-Yl)Acetic Acid No suppilers available for the product. |
| Name | (1,5-Diphenyl-1H-Pyrazol-4-Yl)Acetic Acid |
|---|---|
| Synonyms | (1,5-Diphenyl-1H-pyrazol-4-yl)acetic acid #; 1H-Pyrazole-4-acetic acid, 1,5-diphenyl-; Pyrazole-4-acetic acid, 1,5-diphenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 |
| CAS Registry Number | 32702-05-9 |
| SMILES | O=C(O)Cc2cnn(c1ccccc1)c2c3ccccc3 |
| InChI | 1S/C17H14N2O2/c20-16(21)11-14-12-18-19(15-9-5-2-6-10-15)17(14)13-7-3-1-4-8-13/h1-10,12H,11H2,(H,20,21) |
| InChIKey | KDKPYZFRLJPORS-UHFFFAOYSA-N |
| Density | 1.206g/cm3 (Cal.) |
|---|---|
| Boiling point | 503.618°C at 760 mmHg (Cal.) |
| Flash point | 258.379°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1,5-Diphenyl-1H-Pyrazol-4-Yl)Acetic Acid |