Online Database of Chemicals from Around the World
|
CAS#: 63378-86-9 Product: 1,2-Diphenylpyrazolidine No suppilers available for the product. |
| Name | 1,2-Diphenylpyrazolidine |
|---|---|
| Synonyms | Nsc297104; Pyrazolidine,1,2-Diphenyl-; 1,2-Diphenylpyrazolidine |
| Molecular Structure |  |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.30 |
| CAS Registry Number | 63378-86-9 |
| SMILES | C3=C(N2N(C1=CC=CC=C1)CCC2)C=CC=C3 |
| InChI | 1S/C15H16N2/c1-3-8-14(9-4-1)16-12-7-13-17(16)15-10-5-2-6-11-15/h1-6,8-11H,7,12-13H2 |
| InChIKey | IRMCWHUVXQCWKI-UHFFFAOYSA-N |
| Density | 1.126g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.208°C at 760 mmHg (Cal.) |
| Flash point | 143.612°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,2-Diphenylpyrazolidine |