|
CAS#: 32741-92-7 Product: Dimethyl 2-(4-Methoxycarbonylphenyl)Benzene-1,4-Dicarboxylate No suppilers available for the product. |
| Name | Dimethyl 2-(4-Methoxycarbonylphenyl)Benzene-1,4-Dicarboxylate |
|---|---|
| Synonyms | 2-(4-Methoxycarbonylphenyl)Benzene-1,4-Dicarboxylic Acid Dimethyl Ester; 2-(4-Carbomethoxyphenyl)Benzene-1,4-Dicarboxylic Acid Dimethyl Ester; 1,1'-Biphenyl-2,4',5-Tricarboxylic Acid, Trimethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 |
| CAS Registry Number | 32741-92-7 |
| EINECS | 251-189-3 |
| SMILES | C1=C(C=CC(=C1)C2=C(C=CC(=C2)C(=O)OC)C(=O)OC)C(=O)OC |
| InChI | 1S/C18H16O6/c1-22-16(19)12-6-4-11(5-7-12)15-10-13(17(20)23-2)8-9-14(15)18(21)24-3/h4-10H,1-3H3 |
| InChIKey | ZLRSGCDCVGSPKI-UHFFFAOYSA-N |
| Density | 1.223g/cm3 (Cal.) |
|---|---|
| Boiling point | 483.359°C at 760 mmHg (Cal.) |
| Flash point | 213.683°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl 2-(4-Methoxycarbonylphenyl)Benzene-1,4-Dicarboxylate |