Online Database of Chemicals from Around the World
|
CAS#: 32792-54-4 Product: (2,4-Dinitrophenyl) 4-Chlorobenzoate No suppilers available for the product. |
| Name | (2,4-Dinitrophenyl) 4-Chlorobenzoate |
|---|---|
| Synonyms | 4-Chlorobenzoic Acid (2,4-Dinitrophenyl) Ester; 4-Chlorobenzoic Acid 2,4-Dinitrophenyl Ester; Benzoic Acid, P-Chloro-, 2,4-Dinitrophenyl Ester |
| Molecular Structure |  |
| Molecular Formula | C13H7ClN2O6 |
| Molecular Weight | 322.66 |
| CAS Registry Number | 32792-54-4 |
| SMILES | C1=CC(=CC=C1Cl)C(=O)OC2=C(C=C(C=C2)[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C13H7ClN2O6/c14-9-3-1-8(2-4-9)13(17)22-12-6-5-10(15(18)19)7-11(12)16(20)21/h1-7H |
| InChIKey | SJFABTRXLXVFME-UHFFFAOYSA-N |
| Density | 1.548g/cm3 (Cal.) |
|---|---|
| Boiling point | 536.098°C at 760 mmHg (Cal.) |
| Flash point | 278.022°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,4-Dinitrophenyl) 4-Chlorobenzoate |