|
CAS#: 6690-51-3 Product: 4-(2',4'-Dinitrophenylazo)-Phenol No suppilers available for the product. |
| Name | 4-(2',4'-Dinitrophenylazo)-Phenol |
|---|---|
| Synonyms | 4-[(2,4-Dinitrophenyl)Hydrazono]Cyclohexa-2,5-Dien-1-One; 4-[(2,4-Dinitrophenyl)Hydrazono]-1-Cyclohexa-2,5-Dienone; Zinc04997297 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8N4O5 |
| Molecular Weight | 288.22 |
| CAS Registry Number | 6690-51-3 |
| SMILES | C1=CC(=CC(=C1NN=C2C=CC(=O)C=C2)[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C12H8N4O5/c17-10-4-1-8(2-5-10)13-14-11-6-3-9(15(18)19)7-12(11)16(20)21/h1-7,14H |
| InChIKey | HJKVTXLZRJZVAT-UHFFFAOYSA-N |
| Density | 1.548g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.228°C at 760 mmHg (Cal.) |
| Flash point | 233.952°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2',4'-Dinitrophenylazo)-Phenol |