Online Database of Chemicals from Around the World
|
CAS#: 32857-46-8 Product: N-(3-Bromophenyl)-N,N'-Dimethyl-N'-Phenyl-1,2-Ethanediamine No suppilers available for the product. |
| Name | N-(3-Bromophenyl)-N,N'-Dimethyl-N'-Phenyl-1,2-Ethanediamine |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C16H19BrN2 |
| Molecular Weight | 319.24 |
| CAS Registry Number | 32857-46-8 |
| SMILES | Brc2cc(N(C)CCN(c1ccccc1)C)ccc2 |
| InChI | 1S/C16H19BrN2/c1-18(15-8-4-3-5-9-15)11-12-19(2)16-10-6-7-14(17)13-16/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | XTHCWAIBXLNWBI-UHFFFAOYSA-N |
| Density | 1.316g/cm3 (Cal.) |
|---|---|
| Boiling point | 429.552°C at 760 mmHg (Cal.) |
| Flash point | 213.586°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3-Bromophenyl)-N,N'-Dimethyl-N'-Phenyl-1,2-Ethanediamine |