|
CAS#: 86945-54-2 Product: 3-(4-Bromophenyl)-N,N-dimethyl-1-indanamine No suppilers available for the product. |
| Name | 3-(4-Bromophenyl)-N,N-dimethyl-1-indanamine |
|---|---|
| Synonyms | [3-(4-Bromo-phenyl)-indan-1-yl]-dimethyl-amine; N,N-Dimethyl-3-(4'-bromophenyl)-1-indanamine; trans-Dbpi |
| Molecular Structure | ![]() |
| Molecular Formula | C17H18BrN |
| Molecular Weight | 316.24 |
| CAS Registry Number | 86945-54-2 |
| SMILES | CN(C)C1CC(C2=CC=CC=C12)C3=CC=C(C=C3)Br |
| InChI | 1S/C17H18BrN/c1-19(2)17-11-16(12-7-9-13(18)10-8-12)14-5-3-4-6-15(14)17/h3-10,16-17H,11H2,1-2H3 |
| InChIKey | FAVRAXVBHORDCR-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.4±42.0°C at 760 mmHg (Cal.) |
| Flash point | 189.3±27.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Bromophenyl)-N,N-dimethyl-1-indanamine |